C33H26FN5O7S2 — CID 131712106
benzhydryl (6R,7R)-7-[[2-[5-fluoro-2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131712106) has the molecular formula C33H26FN5O7S2 and a molecular weight of 687.73 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-[[2-[5-fluoro-2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-7-[[2-[5-fluoro-2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131712106 |
| Molecular Formula | C33H26FN5O7S2 |
| Molecular Weight | 687.73 g/mol |
| Exact Mass | 687.13 |
| IUPAC Name | benzhydryl (6R,7R)-7-[[2-[5-fluoro-2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Nc1nc(C(=NO)C(=O)N[C@@H]2C(=O)N3C(C(=O)OC(c4ccccc4)c4ccccc4)=CCS[C@H]23)c(F)s1)OCc1ccccc1 |
| InChI | InChI=1S/C33H26FN5O7S2/c34-27-23(36-32(48-27)37-33(43)45-18-19-10-4-1-5-11-19)24(38-44)28(40)35-25-29(41)39-22(16-17-47-30(25)39)31(42)46-26(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-16,25-26,30,44H,17-18H2,(H,35,40)(H,36,37,43)/t25-,30-/m1/s1 |
| InChIKey | BHHKGMFOPJMGRQ-FYBSXPHGSA-N |
| XLogP | 4.83 |
| TPSA | 159.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|