C15H10Cl3N3OS — CID 13171460
3-[(2-chloroanilino)methyl]-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 13171460) has the molecular formula C15H10Cl3N3OS and a molecular weight of 386.69 g/mol. Its IUPAC name is 3-[(2-chloroanilino)methyl]-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(2-chloroanilino)methyl]-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 13171460 |
| Molecular Formula | C15H10Cl3N3OS |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 3-[(2-chloroanilino)methyl]-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2ccc(Cl)cc2Cl)nn1CNc1ccccc1Cl |
| InChI | InChI=1S/C15H10Cl3N3OS/c16-9-5-6-10(12(18)7-9)14-20-21(15(23)22-14)8-19-13-4-2-1-3-11(13)17/h1-7,19H,8H2 |
| InChIKey | RLWDWEWFMHCLDB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|