C9H14N2O6S — CID 131715083
(2R,3S)-3-amino-2-[(Z)-4-ethoxy-4-oxobut-2-en-2-yl]-4-oxoazetidine-1-sulfonic acid (PubChem CID 131715083) has the molecular formula C9H14N2O6S and a molecular weight of 278.29 g/mol. Its IUPAC name is (2R,3S)-3-amino-2-[(Z)-4-ethoxy-4-oxobut-2-en-2-yl]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3S)-3-amino-2-[(Z)-4-ethoxy-4-oxobut-2-en-2-yl]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 131715083 |
| Molecular Formula | C9H14N2O6S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (2R,3S)-3-amino-2-[(Z)-4-ethoxy-4-oxobut-2-en-2-yl]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CCOC(=O)/C=C(/C)[C@@H]1[C@H](N)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C9H14N2O6S/c1-3-17-6(12)4-5(2)8-7(10)9(13)11(8)18(14,15)16/h4,7-8H,3,10H2,1-2H3,(H,14,15,16)/b5-4-/t7-,8+/m0/s1 |
| InChIKey | GJXYZWTUAAVTEI-GBSWACPJSA-N |
| XLogP | -1.16 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|