C8H11NO6S — CID 19748795
3-ethenyl-2-ethoxycarbonyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 19748795) has the molecular formula C8H11NO6S and a molecular weight of 249.24 g/mol. Its IUPAC name is 3-ethenyl-2-ethoxycarbonyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-ethenyl-2-ethoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 19748795 |
| Molecular Formula | C8H11NO6S |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 3-ethenyl-2-ethoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | C=CC1C(=O)N(S(=O)(=O)O)C1C(=O)OCC |
| InChI | InChI=1S/C8H11NO6S/c1-3-5-6(8(11)15-4-2)9(7(5)10)16(12,13)14/h3,5-6H,1,4H2,2H3,(H,12,13,14) |
| InChIKey | AMCJLEAZNSKUMJ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|