C17H31NO4S — CID 131719291
ethyl (2S)-2-[[2-(acetylsulfanylmethyl)-4-methylpentanoyl]amino]-4-methylpentanoate (PubChem CID 131719291) has the molecular formula C17H31NO4S and a molecular weight of 345.51 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(acetylsulfanylmethyl)-4-methylpentanoyl]amino]-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-[[2-(acetylsulfanylmethyl)-4-methylpentanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 131719291 |
| Molecular Formula | C17H31NO4S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | ethyl (2S)-2-[[2-(acetylsulfanylmethyl)-4-methylpentanoyl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NC(=O)C(CSC(C)=O)CC(C)C |
| InChI | InChI=1S/C17H31NO4S/c1-7-22-17(21)15(9-12(4)5)18-16(20)14(8-11(2)3)10-23-13(6)19/h11-12,14-15H,7-10H2,1-6H3,(H,18,20)/t14?,15-/m0/s1 |
| InChIKey | WFXVPPRROAJKGU-LOACHALJSA-N |
| XLogP | 3.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|