C19H31F5N2O4S2 — CID 91740559
4-methylpentyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate (PubChem CID 91740559) has the molecular formula C19H31F5N2O4S2 and a molecular weight of 510.59 g/mol. Its IUPAC name is 4-methylpentyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate.
| Compound Name | 4-methylpentyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 91740559 |
| Molecular Formula | C19H31F5N2O4S2 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 4-methylpentyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate |
| SMILES | CSCCC(NC(=O)C(F)(F)C(F)(F)F)C(=O)NC(CCSC)C(=O)OCCCC(C)C |
| InChI | InChI=1S/C19H31F5N2O4S2/c1-12(2)6-5-9-30-16(28)14(8-11-32-4)25-15(27)13(7-10-31-3)26-17(29)18(20,21)19(22,23)24/h12-14H,5-11H2,1-4H3,(H,25,27)(H,26,29) |
| InChIKey | QJUSGMUJNDXBAS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|