C24H39F7N2O4S2 — CID 91694286
decyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 91694286) has the molecular formula C24H39F7N2O4S2 and a molecular weight of 616.71 g/mol. Its IUPAC name is decyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | decyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91694286 |
| Molecular Formula | C24H39F7N2O4S2 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | decyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCCCCCCCOC(=O)C(CCSC)NC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H39F7N2O4S2/c1-4-5-6-7-8-9-10-11-14-37-20(35)18(13-16-39-3)32-19(34)17(12-15-38-2)33-21(36)22(25,26)23(27,28)24(29,30)31/h17-18H,4-16H2,1-3H3,(H,32,34)(H,33,36) |
| InChIKey | FYPVBUFZIFMFLO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|