C14H22F5NO3S — CID 91735715
hexyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 91735715) has the molecular formula C14H22F5NO3S and a molecular weight of 379.39 g/mol. Its IUPAC name is hexyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | hexyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 91735715 |
| Molecular Formula | C14H22F5NO3S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | hexyl 4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCCCCCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H22F5NO3S/c1-3-4-5-6-8-23-11(21)10(7-9-24-2)20-12(22)13(15,16)14(17,18)19/h10H,3-9H2,1-2H3,(H,20,22) |
| InChIKey | WZLUIWQFKXPIIW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|