C18H27F7N2O4S2 — CID 91694304
butyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 91694304) has the molecular formula C18H27F7N2O4S2 and a molecular weight of 532.54 g/mol. Its IUPAC name is butyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | butyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91694304 |
| Molecular Formula | C18H27F7N2O4S2 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | butyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCOC(=O)C(CCSC)NC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H27F7N2O4S2/c1-4-5-8-31-14(29)12(7-10-33-3)26-13(28)11(6-9-32-2)27-15(30)16(19,20)17(21,22)18(23,24)25/h11-12H,4-10H2,1-3H3,(H,26,28)(H,27,30) |
| InChIKey | WTQUSXVTKMWINQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|