C19H29F7N2O4S2 — CID 91694285
pentyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 91694285) has the molecular formula C19H29F7N2O4S2 and a molecular weight of 546.57 g/mol. Its IUPAC name is pentyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | pentyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91694285 |
| Molecular Formula | C19H29F7N2O4S2 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | pentyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCCOC(=O)C(CCSC)NC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H29F7N2O4S2/c1-4-5-6-9-32-15(30)13(8-11-34-3)27-14(29)12(7-10-33-2)28-16(31)17(20,21)18(22,23)19(24,25)26/h12-13H,4-11H2,1-3H3,(H,27,29)(H,28,31) |
| InChIKey | ALECNXNWJGRPCE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|