C35H24Cl2N3NaO5 — CID 131720458
sodium 3,3-bis[4-[(7-chloroquinolin-2-yl)methoxy]phenyl]-2-hydroxyiminopropanoate (PubChem CID 131720458) has the molecular formula C35H24Cl2N3NaO5 and a molecular weight of 660.49 g/mol. Its IUPAC name is sodium 3,3-bis[4-[(7-chloroquinolin-2-yl)methoxy]phenyl]-2-hydroxyiminopropanoate.
| Compound Name | sodium 3,3-bis[4-[(7-chloroquinolin-2-yl)methoxy]phenyl]-2-hydroxyiminopropanoate |
|---|---|
| PubChem CID | 131720458 |
| Molecular Formula | C35H24Cl2N3NaO5 |
| Molecular Weight | 660.49 g/mol |
| Exact Mass | 659.10 |
| IUPAC Name | sodium 3,3-bis[4-[(7-chloroquinolin-2-yl)methoxy]phenyl]-2-hydroxyiminopropanoate |
| SMILES | O=C([O-])C(=NO)C(c1ccc(OCc2ccc3ccc(Cl)cc3n2)cc1)c1ccc(OCc2ccc3ccc(Cl)cc3n2)cc1.[Na+] |
| InChI | InChI=1S/C35H25Cl2N3O5.Na/c36-25-9-1-21-3-11-27(38-31(21)17-25)19-44-29-13-5-23(6-14-29)33(34(40-43)35(41)42)24-7-15-30(16-8-24)45-20-28-12-4-22-2-10-26(37)18-32(22)39-28;/h1-18,33,43H,19-20H2,(H,41,42);/q;+1/p-1 |
| InChIKey | DWWGBNBWVAGUBR-UHFFFAOYSA-M |
| XLogP | 3.96 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|