C25H31N5O7S — CID 131723168
2-[(3S)-3-[3-amino-3-[[(4-methylphenyl)sulfonylamino]methylimino]propyl]-2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl]acetic acid (PubChem CID 131723168) has the molecular formula C25H31N5O7S and a molecular weight of 545.62 g/mol. Its IUPAC name is 2-[(3S)-3-[3-amino-3-[[(4-methylphenyl)sulfonylamino]methylimino]propyl]-2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl]acetic acid.
| Compound Name | 2-[(3S)-3-[3-amino-3-[[(4-methylphenyl)sulfonylamino]methylimino]propyl]-2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 131723168 |
| Molecular Formula | C25H31N5O7S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 2-[(3S)-3-[3-amino-3-[[(4-methylphenyl)sulfonylamino]methylimino]propyl]-2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCN=C(N)CC[C@H]2C(=O)N(CC(=O)O)CCN2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H31N5O7S/c1-18-7-9-20(10-8-18)38(35,36)28-17-27-22(26)12-11-21-24(33)29(15-23(31)32)13-14-30(21)25(34)37-16-19-5-3-2-4-6-19/h2-10,21,28H,11-17H2,1H3,(H2,26,27)(H,31,32)/t21-/m0/s1 |
| InChIKey | RMINUMSODMENAC-NRFANRHFSA-N |
| XLogP | 1.30 |
| TPSA | 171.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|