C23H36N8O5 — CID 24798888
benzyl (8S)-10-(2-amino-2-oxoethyl)-8-[3-(diaminomethylideneamino)propyl]-2,9-dioxo-1,3,7,10-tetrazacyclotridecane-7-carboxylate (PubChem CID 24798888) has the molecular formula C23H36N8O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is benzyl (8S)-10-(2-amino-2-oxoethyl)-8-[3-(diaminomethylideneamino)propyl]-2,9-dioxo-1,3,7,10-tetrazacyclotridecane-7-carboxylate.
| Compound Name | benzyl (8S)-10-(2-amino-2-oxoethyl)-8-[3-(diaminomethylideneamino)propyl]-2,9-dioxo-1,3,7,10-tetrazacyclotridecane-7-carboxylate |
|---|---|
| PubChem CID | 24798888 |
| Molecular Formula | C23H36N8O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | benzyl (8S)-10-(2-amino-2-oxoethyl)-8-[3-(diaminomethylideneamino)propyl]-2,9-dioxo-1,3,7,10-tetrazacyclotridecane-7-carboxylate |
| SMILES | NC(=O)CN1CCCNC(=O)NCCCN(C(=O)OCc2ccccc2)[C@@H](CCCN=C(N)N)C1=O |
| InChI | InChI=1S/C23H36N8O5/c24-19(32)15-30-13-5-11-28-22(34)29-12-6-14-31(18(20(30)33)9-4-10-27-21(25)26)23(35)36-16-17-7-2-1-3-8-17/h1-3,7-8,18H,4-6,9-16H2,(H2,24,32)(H4,25,26,27)(H2,28,29,34)/t18-/m0/s1 |
| InChIKey | OUXKYFVCDPRGCN-SFHVURJKSA-N |
| XLogP | -0.55 |
| TPSA | 198.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|