C9H17F3N2O3 — CID 131724001
1-(2-aminoethyl)piperidin-4-ol;2,2,2-trifluoroacetic acid (PubChem CID 131724001) has the molecular formula C9H17F3N2O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 1-(2-aminoethyl)piperidin-4-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(2-aminoethyl)piperidin-4-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 131724001 |
| Molecular Formula | C9H17F3N2O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(2-aminoethyl)piperidin-4-ol;2,2,2-trifluoroacetic acid |
| SMILES | NCCN1CCC(O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H16N2O.C2HF3O2/c8-3-6-9-4-1-7(10)2-5-9;3-2(4,5)1(6)7/h7,10H,1-6,8H2;(H,6,7) |
| InChIKey | OHIVDSKFOWOETE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |