C13H26N4O2 — CID 131725568
(2S)-N-[2-(diethylamino)ethyl]-4-ethoxyiminopyrrolidine-2-carboxamide (PubChem CID 131725568) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is (2S)-N-[2-(diethylamino)ethyl]-4-ethoxyiminopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[2-(diethylamino)ethyl]-4-ethoxyiminopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131725568 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (2S)-N-[2-(diethylamino)ethyl]-4-ethoxyiminopyrrolidine-2-carboxamide |
| SMILES | CCON=C1CN[C@H](C(=O)NCCN(CC)CC)C1 |
| InChI | InChI=1S/C13H26N4O2/c1-4-17(5-2)8-7-14-13(18)12-9-11(10-15-12)16-19-6-3/h12,15H,4-10H2,1-3H3,(H,14,18)/t12-/m0/s1 |
| InChIKey | UTHVBLSVSRXWIW-LBPRGKRZSA-N |
| XLogP | 0.20 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|