C11H21N5O4 — CID 131726550
(2S)-6-(2-diazohydrazinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 131726550) has the molecular formula C11H21N5O4 and a molecular weight of 287.32 g/mol. Its IUPAC name is (2S)-6-(2-diazohydrazinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-6-(2-diazohydrazinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 131726550 |
| Molecular Formula | C11H21N5O4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2S)-6-(2-diazohydrazinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNN=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C11H21N5O4/c1-11(2,3)20-10(19)14-8(9(17)18)6-4-5-7-13-16-15-12/h8,13H,4-7H2,1-3H3,(H,14,19)(H,17,18)/t8-/m0/s1 |
| InChIKey | YOKIYMFCZGWBLT-QMMMGPOBSA-N |
| XLogP | 1.95 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|