C19H26N2O3S2Si — CID 131726771
2-(6-tert-butyl-4-dimethylsilyloxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid (PubChem CID 131726771) has the molecular formula C19H26N2O3S2Si and a molecular weight of 422.65 g/mol. Its IUPAC name is 2-(6-tert-butyl-4-dimethylsilyloxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(6-tert-butyl-4-dimethylsilyloxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 131726771 |
| Molecular Formula | C19H26N2O3S2Si |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-(6-tert-butyl-4-dimethylsilyloxy-1,3-benzothiazol-2-yl)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
| SMILES | C[SiH](C)Oc1cc(C(C)(C)C)cc2sc(C3=NC(C(=O)O)C(C)(C)S3)nc12 |
| InChI | InChI=1S/C19H26N2O3S2Si/c1-18(2,3)10-8-11(24-27(6)7)13-12(9-10)25-15(20-13)16-21-14(17(22)23)19(4,5)26-16/h8-9,14,27H,1-7H3,(H,22,23) |
| InChIKey | QGBWUPQXYWNNPF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|