C24H38Cl2N2O3S — CID 131728650
6-butyl-8-[1-(2-tert-butylsulfonylethyl)piperidin-4-yl]oxyquinoline;dihydrochloride (PubChem CID 131728650) has the molecular formula C24H38Cl2N2O3S and a molecular weight of 505.55 g/mol. Its IUPAC name is 6-butyl-8-[1-(2-tert-butylsulfonylethyl)piperidin-4-yl]oxyquinoline;dihydrochloride.
| Compound Name | 6-butyl-8-[1-(2-tert-butylsulfonylethyl)piperidin-4-yl]oxyquinoline;dihydrochloride |
|---|---|
| PubChem CID | 131728650 |
| Molecular Formula | C24H38Cl2N2O3S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 6-butyl-8-[1-(2-tert-butylsulfonylethyl)piperidin-4-yl]oxyquinoline;dihydrochloride |
| SMILES | CCCCc1cc(OC2CCN(CCS(=O)(=O)C(C)(C)C)CC2)c2ncccc2c1.Cl.Cl |
| InChI | InChI=1S/C24H36N2O3S.2ClH/c1-5-6-8-19-17-20-9-7-12-25-23(20)22(18-19)29-21-10-13-26(14-11-21)15-16-30(27,28)24(2,3)4;;/h7,9,12,17-18,21H,5-6,8,10-11,13-16H2,1-4H3;2*1H |
| InChIKey | FGPYMTNNFRFLLF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |