C26H39N3O2 — CID 25263959
N-tert-butyl-4-[4-(6-butylquinolin-8-yl)oxypiperidin-1-yl]butanamide (PubChem CID 25263959) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is N-tert-butyl-4-[4-(6-butylquinolin-8-yl)oxypiperidin-1-yl]butanamide.
| Compound Name | N-tert-butyl-4-[4-(6-butylquinolin-8-yl)oxypiperidin-1-yl]butanamide |
|---|---|
| PubChem CID | 25263959 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | N-tert-butyl-4-[4-(6-butylquinolin-8-yl)oxypiperidin-1-yl]butanamide |
| SMILES | CCCCc1cc(OC2CCN(CCCC(=O)NC(C)(C)C)CC2)c2ncccc2c1 |
| InChI | InChI=1S/C26H39N3O2/c1-5-6-9-20-18-21-10-7-14-27-25(21)23(19-20)31-22-12-16-29(17-13-22)15-8-11-24(30)28-26(2,3)4/h7,10,14,18-19,22H,5-6,8-9,11-13,15-17H2,1-4H3,(H,28,30) |
| InChIKey | BLTYHNPKGRKLGX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |