C25H36N2O3 — CID 68732155
2-methylpropyl 4-(6-hexylquinolin-8-yl)oxypiperidine-1-carboxylate (PubChem CID 68732155) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-methylpropyl 4-(6-hexylquinolin-8-yl)oxypiperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-(6-hexylquinolin-8-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68732155 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 2-methylpropyl 4-(6-hexylquinolin-8-yl)oxypiperidine-1-carboxylate |
| SMILES | CCCCCCc1cc(OC2CCN(C(=O)OCC(C)C)CC2)c2ncccc2c1 |
| InChI | InChI=1S/C25H36N2O3/c1-4-5-6-7-9-20-16-21-10-8-13-26-24(21)23(17-20)30-22-11-14-27(15-12-22)25(28)29-18-19(2)3/h8,10,13,16-17,19,22H,4-7,9,11-12,14-15,18H2,1-3H3 |
| InChIKey | FMWBVATZLQIWNC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|