C22H31N2O3+ — CID 68729880
(3R)-1-tert-butyl-3-(6-butylquinolin-8-yl)oxypyrrolidin-1-ium-1-carboxylic acid (PubChem CID 68729880) has the molecular formula C22H31N2O3+ and a molecular weight of 371.50 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-(6-butylquinolin-8-yl)oxypyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (3R)-1-tert-butyl-3-(6-butylquinolin-8-yl)oxypyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 68729880 |
| Molecular Formula | C22H31N2O3+ |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | (3R)-1-tert-butyl-3-(6-butylquinolin-8-yl)oxypyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCCCc1cc(O[C@@H]2CC[N+](C(=O)O)(C(C)(C)C)C2)c2ncccc2c1 |
| InChI | InChI=1S/C22H30N2O3/c1-5-6-8-16-13-17-9-7-11-23-20(17)19(14-16)27-18-10-12-24(15-18,21(25)26)22(2,3)4/h7,9,11,13-14,18H,5-6,8,10,12,15H2,1-4H3/p+1/t18-,24?/m1/s1 |
| InChIKey | QZWBCXTZJZTMQF-QFADGXAASA-O |
| XLogP | 5.02 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|