C21H28N2O3 — CID 67068370
[cyclopropyl-[6-(3-hydroxypropyl)quinolin-8-yl]methyl] N-tert-butylcarbamate (PubChem CID 67068370) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is [cyclopropyl-[6-(3-hydroxypropyl)quinolin-8-yl]methyl] N-tert-butylcarbamate.
| Compound Name | [cyclopropyl-[6-(3-hydroxypropyl)quinolin-8-yl]methyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 67068370 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [cyclopropyl-[6-(3-hydroxypropyl)quinolin-8-yl]methyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(c1cc(CCCO)cc2cccnc12)C1CC1 |
| InChI | InChI=1S/C21H28N2O3/c1-21(2,3)23-20(25)26-19(15-8-9-15)17-13-14(6-5-11-24)12-16-7-4-10-22-18(16)17/h4,7,10,12-13,15,19,24H,5-6,8-9,11H2,1-3H3,(H,23,25) |
| InChIKey | VRLOPVPFWSEGCM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |