C34H29F2O5S2+ — CID 131729204
benzhydryl(phenyl)sulfanium;1,1-difluoro-2-(4-phenylbenzoyl)oxyethanesulfonic acid (PubChem CID 131729204) has the molecular formula C34H29F2O5S2+ and a molecular weight of 619.73 g/mol. Its IUPAC name is benzhydryl(phenyl)sulfanium;1,1-difluoro-2-(4-phenylbenzoyl)oxyethanesulfonic acid.
| Compound Name | benzhydryl(phenyl)sulfanium;1,1-difluoro-2-(4-phenylbenzoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 131729204 |
| Molecular Formula | C34H29F2O5S2+ |
| Molecular Weight | 619.73 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | benzhydryl(phenyl)sulfanium;1,1-difluoro-2-(4-phenylbenzoyl)oxyethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1ccc(-c2ccccc2)cc1.c1ccc([SH+]C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16S.C15H12F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;16-15(17,23(19,20)21)10-22-14(18)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-15,19H;1-9H,10H2,(H,19,20,21)/p+1 |
| InChIKey | ZKBXRPJKQQWAOT-UHFFFAOYSA-O |
| XLogP | 7.64 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.73 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|