C13H23N3O4S — CID 131734075
tert-butyl N-[1-(2-methyl-1-methylsulfonylpropan-2-yl)pyrazol-4-yl]carbamate (PubChem CID 131734075) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is tert-butyl N-[1-(2-methyl-1-methylsulfonylpropan-2-yl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-methyl-1-methylsulfonylpropan-2-yl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 131734075 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | tert-butyl N-[1-(2-methyl-1-methylsulfonylpropan-2-yl)pyrazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnn(C(C)(C)CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H23N3O4S/c1-12(2,3)20-11(17)15-10-7-14-16(8-10)13(4,5)9-21(6,18)19/h7-8H,9H2,1-6H3,(H,15,17) |
| InChIKey | IMALRAGXAZOIHN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |