C15H21N5O4S — CID 162520246
tert-butyl N-[1-[(4-methyl-2-methylsulfonylpyrimidin-5-yl)methyl]pyrazol-4-yl]carbamate (PubChem CID 162520246) has the molecular formula C15H21N5O4S and a molecular weight of 367.43 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-methyl-2-methylsulfonylpyrimidin-5-yl)methyl]pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-methyl-2-methylsulfonylpyrimidin-5-yl)methyl]pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 162520246 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | tert-butyl N-[1-[(4-methyl-2-methylsulfonylpyrimidin-5-yl)methyl]pyrazol-4-yl]carbamate |
| SMILES | Cc1nc(S(C)(=O)=O)ncc1Cn1cc(NC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C15H21N5O4S/c1-10-11(6-16-13(18-10)25(5,22)23)8-20-9-12(7-17-20)19-14(21)24-15(2,3)4/h6-7,9H,8H2,1-5H3,(H,19,21) |
| InChIKey | NXEMTJMMWOIGDG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |