C30H35ClFN5O4 — CID 131734621
tert-butyl N-[4-[5-amino-6-[4-[[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamoyl]-3-fluorophenyl]pyrazin-2-yl]cyclohexyl]carbamate (PubChem CID 131734621) has the molecular formula C30H35ClFN5O4 and a molecular weight of 584.09 g/mol. Its IUPAC name is tert-butyl N-[4-[5-amino-6-[4-[[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamoyl]-3-fluorophenyl]pyrazin-2-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-amino-6-[4-[[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamoyl]-3-fluorophenyl]pyrazin-2-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 131734621 |
| Molecular Formula | C30H35ClFN5O4 |
| Molecular Weight | 584.09 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | tert-butyl N-[4-[5-amino-6-[4-[[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamoyl]-3-fluorophenyl]pyrazin-2-yl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(c2cnc(N)c(-c3ccc(C(=O)N[C@H](CO)c4cccc(Cl)c4)c(F)c3)n2)CC1 |
| InChI | InChI=1S/C30H35ClFN5O4/c1-30(2,3)41-29(40)35-21-10-7-17(8-11-21)24-15-34-27(33)26(36-24)19-9-12-22(23(32)14-19)28(39)37-25(16-38)18-5-4-6-20(31)13-18/h4-6,9,12-15,17,21,25,38H,7-8,10-11,16H2,1-3H3,(H2,33,34)(H,35,40)(H,37,39)/t17?,21?,25-/m1/s1 |
| InChIKey | AFRDNHDLRRYECQ-PXSGXWBPSA-N |
| XLogP | 5.53 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.09 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |