C11H7ClO — CID 131737169
3-(7-bicyclo[4.2.0]octa-1(8),2,4,6-tetraenyl)prop-2-enoyl chloride (PubChem CID 131737169) has the molecular formula C11H7ClO and a molecular weight of 190.63 g/mol. Its IUPAC name is 3-(7-bicyclo[4.2.0]octa-1(8),2,4,6-tetraenyl)prop-2-enoyl chloride.
| Compound Name | 3-(7-bicyclo[4.2.0]octa-1(8),2,4,6-tetraenyl)prop-2-enoyl chloride |
|---|---|
| PubChem CID | 131737169 |
| Molecular Formula | C11H7ClO |
| Molecular Weight | 190.63 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 3-(7-bicyclo[4.2.0]octa-1(8),2,4,6-tetraenyl)prop-2-enoyl chloride |
| SMILES | O=C(Cl)C=CC1=c2ccccc2=C1 |
| InChI | InChI=1S/C11H7ClO/c12-11(13)6-5-9-7-8-3-1-2-4-10(8)9/h1-7H |
| InChIKey | VIRJKNQCASAXJU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.63 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|