C30H33N5O2S — CID 131738074
tert-butyl N-[3-[3-[2-(1H-indol-3-yl)ethylsulfanyl]-5-naphthalen-2-yl-1,2,4-triazol-4-yl]propyl]carbamate (PubChem CID 131738074) has the molecular formula C30H33N5O2S and a molecular weight of 527.69 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[2-(1H-indol-3-yl)ethylsulfanyl]-5-naphthalen-2-yl-1,2,4-triazol-4-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[2-(1H-indol-3-yl)ethylsulfanyl]-5-naphthalen-2-yl-1,2,4-triazol-4-yl]propyl]carbamate |
|---|---|
| PubChem CID | 131738074 |
| Molecular Formula | C30H33N5O2S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | tert-butyl N-[3-[3-[2-(1H-indol-3-yl)ethylsulfanyl]-5-naphthalen-2-yl-1,2,4-triazol-4-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCn1c(SCCc2c[nH]c3ccccc23)nnc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H33N5O2S/c1-30(2,3)37-29(36)31-16-8-17-35-27(23-14-13-21-9-4-5-10-22(21)19-23)33-34-28(35)38-18-15-24-20-32-26-12-7-6-11-25(24)26/h4-7,9-14,19-20,32H,8,15-18H2,1-3H3,(H,31,36) |
| InChIKey | SRDOYUGSGBEUGE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|