C9H6ClF2O3- — CID 131738240
2-[4-chloro-3-(difluoromethoxy)phenyl]acetate (PubChem CID 131738240) has the molecular formula C9H6ClF2O3- and a molecular weight of 235.59 g/mol. Its IUPAC name is 2-[4-chloro-3-(difluoromethoxy)phenyl]acetate.
| Compound Name | 2-[4-chloro-3-(difluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 131738240 |
| Molecular Formula | C9H6ClF2O3- |
| Molecular Weight | 235.59 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 2-[4-chloro-3-(difluoromethoxy)phenyl]acetate |
| SMILES | O=C([O-])Cc1ccc(Cl)c(OC(F)F)c1 |
| InChI | InChI=1S/C9H7ClF2O3/c10-6-2-1-5(4-8(13)14)3-7(6)15-9(11)12/h1-3,9H,4H2,(H,13,14)/p-1 |
| InChIKey | UVHFRJPDJVRABV-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.59 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |