C8H8F2O2S — CID 131739652
1,6-bis(fluoromethyl)-5-sulfonylcyclohexa-1,3-diene (PubChem CID 131739652) has the molecular formula C8H8F2O2S and a molecular weight of 206.21 g/mol. Its IUPAC name is 1,6-bis(fluoromethyl)-5-sulfonylcyclohexa-1,3-diene.
| Compound Name | 1,6-bis(fluoromethyl)-5-sulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 131739652 |
| Molecular Formula | C8H8F2O2S |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 1,6-bis(fluoromethyl)-5-sulfonylcyclohexa-1,3-diene |
| SMILES | O=S(=O)=C1C=CC=C(CF)C1CF |
| InChI | InChI=1S/C8H8F2O2S/c9-4-6-2-1-3-8(13(11)12)7(6)5-10/h1-3,7H,4-5H2 |
| InChIKey | SEBSUTPJOORDBH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|