C10H10O2S — CID 140768424
5-buta-1,3-dienyl-6-sulfonylcyclohexa-1,3-diene (PubChem CID 140768424) has the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. Its IUPAC name is 5-buta-1,3-dienyl-6-sulfonylcyclohexa-1,3-diene.
| Compound Name | 5-buta-1,3-dienyl-6-sulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 140768424 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 5-buta-1,3-dienyl-6-sulfonylcyclohexa-1,3-diene |
| SMILES | C=CC=CC1C=CC=CC1=S(=O)=O |
| InChI | InChI=1S/C10H10O2S/c1-2-3-6-9-7-4-5-8-10(9)13(11)12/h2-9H,1H2 |
| InChIKey | JZJYWJWYWKVQRR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|