C9H6F6O3S — CID 150662074
4-methylidene-2,3-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 150662074) has the molecular formula C9H6F6O3S and a molecular weight of 308.20 g/mol. Its IUPAC name is 4-methylidene-2,3-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 4-methylidene-2,3-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 150662074 |
| Molecular Formula | C9H6F6O3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 4-methylidene-2,3-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | C=C1C=CC(S(=O)(=O)O)=C(C(F)(F)F)C1C(F)(F)F |
| InChI | InChI=1S/C9H6F6O3S/c1-4-2-3-5(19(16,17)18)7(9(13,14)15)6(4)8(10,11)12/h2-3,6H,1H2,(H,16,17,18) |
| InChIKey | JEBXHBQVVBOUFF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|