C10H12F2O3S — CID 144521129
(2,5-dimethylcyclohepta-2,4,6-trien-1-yl)-difluoromethanesulfonic acid (PubChem CID 144521129) has the molecular formula C10H12F2O3S and a molecular weight of 250.27 g/mol. Its IUPAC name is (2,5-dimethylcyclohepta-2,4,6-trien-1-yl)-difluoromethanesulfonic acid.
| Compound Name | (2,5-dimethylcyclohepta-2,4,6-trien-1-yl)-difluoromethanesulfonic acid |
|---|---|
| PubChem CID | 144521129 |
| Molecular Formula | C10H12F2O3S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (2,5-dimethylcyclohepta-2,4,6-trien-1-yl)-difluoromethanesulfonic acid |
| SMILES | CC1=CC=C(C)C(C(F)(F)S(=O)(=O)O)C=C1 |
| InChI | InChI=1S/C10H12F2O3S/c1-7-3-5-8(2)9(6-4-7)10(11,12)16(13,14)15/h3-6,9H,1-2H3,(H,13,14,15) |
| InChIKey | XKNYSPVWFKGODV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|