C7H5F3O2S — CID 142692100
5-sulfonyl-1-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 142692100) has the molecular formula C7H5F3O2S and a molecular weight of 210.18 g/mol. Its IUPAC name is 5-sulfonyl-1-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 5-sulfonyl-1-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142692100 |
| Molecular Formula | C7H5F3O2S |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 5-sulfonyl-1-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | O=S(=O)=C1C=CC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C7H5F3O2S/c8-7(9,10)5-2-1-3-6(4-5)13(11)12/h1-3H,4H2 |
| InChIKey | QPGFOBZXEDNQGR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|