C34H35N5O6S2 — CID 131739745
tert-butyl N-[1-[[3-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]phenyl]sulfonylamino]-1-oxo-4-phenylbutan-2-yl]carbamate (PubChem CID 131739745) has the molecular formula C34H35N5O6S2 and a molecular weight of 673.82 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]phenyl]sulfonylamino]-1-oxo-4-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]phenyl]sulfonylamino]-1-oxo-4-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 131739745 |
| Molecular Formula | C34H35N5O6S2 |
| Molecular Weight | 673.82 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | tert-butyl N-[1-[[3-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]phenyl]sulfonylamino]-1-oxo-4-phenylbutan-2-yl]carbamate |
| SMILES | CC(=NNc1nc2ccccc2s1)c1ccc(-c2cccc(S(=O)(=O)NC(=O)C(CCc3ccccc3)NC(=O)OC(C)(C)C)c2)o1 |
| InChI | InChI=1S/C34H35N5O6S2/c1-22(37-38-32-35-26-15-8-9-16-30(26)46-32)28-19-20-29(44-28)24-13-10-14-25(21-24)47(42,43)39-31(40)27(36-33(41)45-34(2,3)4)18-17-23-11-6-5-7-12-23/h5-16,19-21,27H,17-18H2,1-4H3,(H,35,38)(H,36,41)(H,39,40) |
| InChIKey | UMBJPEFZTIGXFG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 151.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.82 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|