C20H14ClN3O3S — CID 74430210
5-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 74430210) has the molecular formula C20H14ClN3O3S and a molecular weight of 411.87 g/mol. Its IUPAC name is 5-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 74430210 |
| Molecular Formula | C20H14ClN3O3S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 5-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | CC(=NNc1nc2ccccc2s1)c1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C20H14ClN3O3S/c1-11(23-24-20-22-15-4-2-3-5-18(15)28-20)16-8-9-17(27-16)12-6-7-14(21)13(10-12)19(25)26/h2-10H,1H3,(H,22,24)(H,25,26) |
| InChIKey | HUTHJKJCAXGZKP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|