C31H30N4O4S2 — CID 155558530
N-[4-[5-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]phenyl]sulfonyl-6-phenylhexanamide (PubChem CID 155558530) has the molecular formula C31H30N4O4S2 and a molecular weight of 586.74 g/mol. Its IUPAC name is N-[4-[5-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]phenyl]sulfonyl-6-phenylhexanamide.
| Compound Name | N-[4-[5-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]phenyl]sulfonyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 155558530 |
| Molecular Formula | C31H30N4O4S2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | N-[4-[5-[(E)-N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]furan-2-yl]phenyl]sulfonyl-6-phenylhexanamide |
| SMILES | C/C(=N\Nc1nc2ccccc2s1)c1ccc(-c2ccc(S(=O)(=O)NC(=O)CCCCCc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C31H30N4O4S2/c1-22(33-34-31-32-26-13-8-9-14-29(26)40-31)27-20-21-28(39-27)24-16-18-25(19-17-24)41(37,38)35-30(36)15-7-3-6-12-23-10-4-2-5-11-23/h2,4-5,8-11,13-14,16-21H,3,6-7,12,15H2,1H3,(H,32,34)(H,35,36)/b33-22+ |
| InChIKey | PYHRVAJESAVFLT-STKMKYKTSA-N |
| XLogP | 7.00 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|