C28H24N4O4S2 — CID 91001098
N-[3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]phenyl]sulfonyl-3-phenylpropanamide (PubChem CID 91001098) has the molecular formula C28H24N4O4S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is N-[3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]phenyl]sulfonyl-3-phenylpropanamide.
| Compound Name | N-[3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]phenyl]sulfonyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 91001098 |
| Molecular Formula | C28H24N4O4S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | N-[3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]phenyl]sulfonyl-3-phenylpropanamide |
| SMILES | CC(/N=N/c1nc2ccccc2s1)c1ccc(-c2cccc(S(=O)(=O)NC(=O)CCc3ccccc3)c2)o1 |
| InChI | InChI=1S/C28H24N4O4S2/c1-19(30-31-28-29-23-12-5-6-13-26(23)37-28)24-15-16-25(36-24)21-10-7-11-22(18-21)38(34,35)32-27(33)17-14-20-8-3-2-4-9-20/h2-13,15-16,18-19H,14,17H2,1H3,(H,32,33)/b31-30+ |
| InChIKey | MNDDPEPSSXCUTD-NVQSTNCTSA-N |
| XLogP | 6.84 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|