C21H15N3O5S — CID 91898688
5-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 91898688) has the molecular formula C21H15N3O5S and a molecular weight of 421.43 g/mol. Its IUPAC name is 5-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91898688 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 5-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | CC(/N=N/c1nc2ccccc2s1)c1ccc(-c2cc(C(=O)O)cc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C21H15N3O5S/c1-11(23-24-21-22-15-4-2-3-5-18(15)30-21)16-6-7-17(29-16)12-8-13(19(25)26)10-14(9-12)20(27)28/h2-11H,1H3,(H,25,26)(H,27,28)/b24-23+ |
| InChIKey | IPLYWYKPTUZLAZ-WCWDXBQESA-N |
| XLogP | 5.80 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|