C19H14N4S — CID 91896126
1,3-benzothiazol-2-yl-[phenyl(pyridin-2-yl)methyl]diazene (PubChem CID 91896126) has the molecular formula C19H14N4S and a molecular weight of 330.42 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl-[phenyl(pyridin-2-yl)methyl]diazene.
| Compound Name | 1,3-benzothiazol-2-yl-[phenyl(pyridin-2-yl)methyl]diazene |
|---|---|
| PubChem CID | 91896126 |
| Molecular Formula | C19H14N4S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1,3-benzothiazol-2-yl-[phenyl(pyridin-2-yl)methyl]diazene |
| SMILES | c1ccc(C(/N=N/c2nc3ccccc3s2)c2ccccn2)cc1 |
| InChI | InChI=1S/C19H14N4S/c1-2-8-14(9-3-1)18(16-11-6-7-13-20-16)22-23-19-21-15-10-4-5-12-17(15)24-19/h1-13,18H/b23-22+ |
| InChIKey | XYTANBRTRZCNAC-GHVJWSGMSA-N |
| XLogP | 5.56 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|