C18H13N3O2S3 — CID 90868489
5-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]thiophen-2-yl]thiophene-2-carboxylic acid (PubChem CID 90868489) has the molecular formula C18H13N3O2S3 and a molecular weight of 399.52 g/mol. Its IUPAC name is 5-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]thiophen-2-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]thiophen-2-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 90868489 |
| Molecular Formula | C18H13N3O2S3 |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 5-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]thiophen-2-yl]thiophene-2-carboxylic acid |
| SMILES | CC(/N=N/c1nc2ccccc2s1)c1ccc(-c2ccc(C(=O)O)s2)s1 |
| InChI | InChI=1S/C18H13N3O2S3/c1-10(20-21-18-19-11-4-2-3-5-13(11)26-18)12-6-7-14(24-12)15-8-9-16(25-15)17(22)23/h2-10H,1H3,(H,22,23)/b21-20+ |
| InChIKey | WCGUKWXRZZAQNU-QZQOTICOSA-N |
| XLogP | 6.63 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|