C21H17ClN4O4S2 — CID 90723709
N-[3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]-4-chlorophenyl]sulfonylacetamide (PubChem CID 90723709) has the molecular formula C21H17ClN4O4S2 and a molecular weight of 488.98 g/mol. Its IUPAC name is N-[3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]-4-chlorophenyl]sulfonylacetamide.
| Compound Name | N-[3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]-4-chlorophenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 90723709 |
| Molecular Formula | C21H17ClN4O4S2 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | N-[3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]-4-chlorophenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(Cl)c(-c2ccc(C(C)/N=N/c3nc4ccccc4s3)o2)c1 |
| InChI | InChI=1S/C21H17ClN4O4S2/c1-12(24-25-21-23-17-5-3-4-6-20(17)31-21)18-9-10-19(30-18)15-11-14(7-8-16(15)22)32(28,29)26-13(2)27/h3-12H,1-2H3,(H,26,27)/b25-24+ |
| InChIKey | IXJKEHXMOYVVGX-OCOZRVBESA-N |
| XLogP | 5.88 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|