C20H15N3O3S — CID 91898692
3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]benzoic acid (PubChem CID 91898692) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is 3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 91898692 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-[5-[1-(1,3-benzothiazol-2-yldiazenyl)ethyl]furan-2-yl]benzoic acid |
| SMILES | CC(/N=N/c1nc2ccccc2s1)c1ccc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C20H15N3O3S/c1-12(22-23-20-21-15-7-2-3-8-18(15)27-20)16-9-10-17(26-16)13-5-4-6-14(11-13)19(24)25/h2-12H,1H3,(H,24,25)/b23-22+ |
| InChIKey | VXBRZBNJAKCQTI-GHVJWSGMSA-N |
| XLogP | 6.10 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|