C40H76O5Si3 — CID 131741562
propan-2-yl (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoate (PubChem CID 131741562) has the molecular formula C40H76O5Si3 and a molecular weight of 721.30 g/mol. Its IUPAC name is propan-2-yl (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoate.
| Compound Name | propan-2-yl (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 131741562 |
| Molecular Formula | C40H76O5Si3 |
| Molecular Weight | 721.30 g/mol |
| Exact Mass | 720.50 |
| IUPAC Name | propan-2-yl (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoate |
| SMILES | CC(=C\C=C\C(C)=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)/C=C(C)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C40H76O5Si3/c1-30(2)42-37(41)26-25-33(5)27-31(3)23-22-24-32(4)28-35(44-47(18,19)39(10,11)12)36(45-48(20,21)40(13,14)15)29-34(6)43-46(16,17)38(7,8)9/h22-28,30,34-36H,29H2,1-21H3/b24-22+,26-25+,31-23+,32-28+,33-27+/t34-,35-,36-/m0/s1 |
| InChIKey | AGVJNGQAMQNWHN-ZAAQSVPQSA-N |
| XLogP | 12.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.30 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|