C13H12IN3S2 — CID 131743130
6-[(3-iodo-2H-pyrazin-1-yl)methyl]-2-methylsulfanyl-1,3-benzothiazole (PubChem CID 131743130) has the molecular formula C13H12IN3S2 and a molecular weight of 401.30 g/mol. Its IUPAC name is 6-[(3-iodo-2H-pyrazin-1-yl)methyl]-2-methylsulfanyl-1,3-benzothiazole.
| Compound Name | 6-[(3-iodo-2H-pyrazin-1-yl)methyl]-2-methylsulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 131743130 |
| Molecular Formula | C13H12IN3S2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.95 |
| IUPAC Name | 6-[(3-iodo-2H-pyrazin-1-yl)methyl]-2-methylsulfanyl-1,3-benzothiazole |
| SMILES | CSc1nc2ccc(CN3C=CN=C(I)C3)cc2s1 |
| InChI | InChI=1S/C13H12IN3S2/c1-18-13-16-10-3-2-9(6-11(10)19-13)7-17-5-4-15-12(14)8-17/h2-6H,7-8H2,1H3 |
| InChIKey | NYDZANOLIFUWQP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|