C20H26N4O3S2 — CID 131744018
(1-cyclopropyl-2,2-dimethylpropyl) N-[(1R,2R)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]thiophen-2-yl]cyclopropyl]carbamate (PubChem CID 131744018) has the molecular formula C20H26N4O3S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is (1-cyclopropyl-2,2-dimethylpropyl) N-[(1R,2R)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]thiophen-2-yl]cyclopropyl]carbamate.
| Compound Name | (1-cyclopropyl-2,2-dimethylpropyl) N-[(1R,2R)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]thiophen-2-yl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 131744018 |
| Molecular Formula | C20H26N4O3S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (1-cyclopropyl-2,2-dimethylpropyl) N-[(1R,2R)-2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)carbamoyl]thiophen-2-yl]cyclopropyl]carbamate |
| SMILES | Cc1nnc(NC(=O)c2csc([C@@H]3C[C@H]3NC(=O)OC(C3CC3)C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C20H26N4O3S2/c1-10-23-24-18(29-10)22-17(25)12-7-15(28-9-12)13-8-14(13)21-19(26)27-16(11-5-6-11)20(2,3)4/h7,9,11,13-14,16H,5-6,8H2,1-4H3,(H,21,26)(H,22,24,25)/t13-,14-,16?/m1/s1 |
| InChIKey | YQDBVTUAHCVGJR-UIDSBSESSA-N |
| XLogP | 4.57 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |