C27H39BrFN3O4SSi — CID 131746149
tert-butyl N-[(1S,5S,6S)-5-(5-bromo-2-fluorophenyl)-1-(cyclopropylcarbamoyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 131746149) has the molecular formula C27H39BrFN3O4SSi and a molecular weight of 628.68 g/mol. Its IUPAC name is tert-butyl N-[(1S,5S,6S)-5-(5-bromo-2-fluorophenyl)-1-(cyclopropylcarbamoyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[(1S,5S,6S)-5-(5-bromo-2-fluorophenyl)-1-(cyclopropylcarbamoyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 131746149 |
| Molecular Formula | C27H39BrFN3O4SSi |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | tert-butyl N-[(1S,5S,6S)-5-(5-bromo-2-fluorophenyl)-1-(cyclopropylcarbamoyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(COCC[Si](C)(C)C)C1=N[C@](C)(c2cc(Br)ccc2F)[C@@H]2C[C@]2(C(=O)NC2CC2)S1 |
| InChI | InChI=1S/C27H39BrFN3O4SSi/c1-25(2,3)36-24(34)32(16-35-12-13-38(5,6)7)23-31-26(4,19-14-17(28)8-11-20(19)29)21-15-27(21,37-23)22(33)30-18-9-10-18/h8,11,14,18,21H,9-10,12-13,15-16H2,1-7H3,(H,30,33)/t21-,26+,27-/m0/s1 |
| InChIKey | FSZRSCRUZTWUCJ-KWTBFXGESA-N |
| XLogP | 6.49 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|