C24H35F2N3O4SSi — CID 131746156
tert-butyl N-[(1S,5S,6S)-1-carbamoyl-5-(2,3-difluorophenyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 131746156) has the molecular formula C24H35F2N3O4SSi and a molecular weight of 527.71 g/mol. Its IUPAC name is tert-butyl N-[(1S,5S,6S)-1-carbamoyl-5-(2,3-difluorophenyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[(1S,5S,6S)-1-carbamoyl-5-(2,3-difluorophenyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 131746156 |
| Molecular Formula | C24H35F2N3O4SSi |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | tert-butyl N-[(1S,5S,6S)-1-carbamoyl-5-(2,3-difluorophenyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(COCC[Si](C)(C)C)C1=N[C@](C)(c2cccc(F)c2F)[C@@H]2C[C@]2(C(N)=O)S1 |
| InChI | InChI=1S/C24H35F2N3O4SSi/c1-22(2,3)33-21(31)29(14-32-11-12-35(5,6)7)20-28-23(4,15-9-8-10-16(25)18(15)26)17-13-24(17,34-20)19(27)30/h8-10,17H,11-14H2,1-7H3,(H2,27,30)/t17-,23+,24-/m0/s1 |
| InChIKey | KIUPNRDKYUFDIY-VWMXVWASSA-N |
| XLogP | 5.08 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|