C26H37F2N3O3SSi — CID 140701896
tert-butyl N-[(1S,5S,6S)-5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-1-prop-1-ynyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 140701896) has the molecular formula C26H37F2N3O3SSi and a molecular weight of 537.75 g/mol. Its IUPAC name is tert-butyl N-[(1S,5S,6S)-5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-1-prop-1-ynyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[(1S,5S,6S)-5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-1-prop-1-ynyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 140701896 |
| Molecular Formula | C26H37F2N3O3SSi |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | tert-butyl N-[(1S,5S,6S)-5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-1-prop-1-ynyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | CC#C[C@]12C[C@H]1[C@@](CF)(c1cc(N)ccc1F)N=C(N(COCC[Si](C)(C)C)C(=O)OC(C)(C)C)S2 |
| InChI | InChI=1S/C26H37F2N3O3SSi/c1-8-11-25-15-21(25)26(16-27,19-14-18(29)9-10-20(19)28)30-22(35-25)31(23(32)34-24(2,3)4)17-33-12-13-36(5,6)7/h9-10,14,21H,12-13,15-17,29H2,1-7H3/t21-,25+,26-/m1/s1 |
| InChIKey | HKIJLUOWRCTLNL-QGUKFAFCSA-N |
| XLogP | 6.01 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|