C25H37BrF2N2O5SSi — CID 140701885
tert-butyl N-[(1S,5S,6R,7R)-5-(5-bromo-2-fluorophenyl)-5-(fluoromethyl)-1,7-bis(hydroxymethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 140701885) has the molecular formula C25H37BrF2N2O5SSi and a molecular weight of 623.63 g/mol. Its IUPAC name is tert-butyl N-[(1S,5S,6R,7R)-5-(5-bromo-2-fluorophenyl)-5-(fluoromethyl)-1,7-bis(hydroxymethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[(1S,5S,6R,7R)-5-(5-bromo-2-fluorophenyl)-5-(fluoromethyl)-1,7-bis(hydroxymethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 140701885 |
| Molecular Formula | C25H37BrF2N2O5SSi |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | tert-butyl N-[(1S,5S,6R,7R)-5-(5-bromo-2-fluorophenyl)-5-(fluoromethyl)-1,7-bis(hydroxymethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(COCC[Si](C)(C)C)C1=N[C@](CF)(c2cc(Br)ccc2F)[C@H]2[C@H](CO)[C@@]2(CO)S1 |
| InChI | InChI=1S/C25H37BrF2N2O5SSi/c1-23(2,3)35-22(33)30(15-34-9-10-37(4,5)6)21-29-24(13-27,17-11-16(26)7-8-19(17)28)20-18(12-31)25(20,14-32)36-21/h7-8,11,18,20,31-32H,9-10,12-15H2,1-6H3/t18-,20+,24+,25+/m0/s1 |
| InChIKey | UABDPUXLSDHCDQ-GWSAJCRFSA-N |
| XLogP | 5.37 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|